CAS 2380932-06-7 is the registry number for tert-Butyl (3R,4S)-4-hydroxy-3-methoxypiperidine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
Tert-butyl (3R,4S)-4-hydroxy-3-methoxypiperidine-1-carboxylate (CAS 2380932-06-7) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: tert-butyl (3R,4S)-4-hydroxy-3-methoxypiperidine-1-carboxylate. InChIKey: LWTOBYXJTDIFEF-DTWKUNHWSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | tert-butyl (3R,4S)-4-hydroxy-3-methoxypiperidine-1-carboxylate |
| InChIKey | LWTOBYXJTDIFEF-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@@H](C1)OC)O |
Computed by PubChem (NCBI)