CAS 1249372-40-4 appears in our catalog under these names: 4-{((tert-butoxy)carbonyl)amino}-4-methylpentanoic acid, 4-((tert-Butoxycarbonyl)amino)-4-methylpentanoic acid 95%, Boc-4-amino-4-methyl-pentanoic acid, 97%, 4-([(tert-Butoxy)carbonyl]amino)-4-methylpentanoic acid, 95%, Boc-4-amino-4-methyl-pentanoic acid, 97%, 97%. Offered by: Biosynth, Ambeed, Fluorochem, Combi-blocks, Chemat. Available pack sizes: 0,5g, 1g, 2g, 5g, 100mg, 250mg, 50mg.
4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 1249372-40-4) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: NFMLOTGNJNBRPQ-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 4-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | NFMLOTGNJNBRPQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)CCC(=O)O |
Computed by PubChem (NCBI)