CAS 35264-07-4 appears in our catalog under these names: Boc-allo-ile-oh, 98%, Boc-allo-Ile-OH, Boc–allo–Ile–OH, Boc-allo-Ile-OH 98%, N-tert-Butoxycarbonyl-L-alloisoleucine, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 2,5g, 100mg.
(2S,3R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 35264-07-4) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (2S,3R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: QJCNLJWUIOIMMF-SFYZADRCSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (2S,3R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | QJCNLJWUIOIMMF-SFYZADRCSA-N |
| SMILES | CC[C@@H](C)[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)