CAS 2381-15-9 is the registry number for 10-Methylbenz(a)anthracene. Offered by: TRC. Available pack sizes: 50mg.
10-methylbenzo[a]anthracene (CAS 2381-15-9) is a chemical compound with the molecular formula C19H14 and a molecular weight of 242.3 g/mol. IUPAC name: 10-methylbenzo[a]anthracene. InChIKey: WUMGYHICFXGLAB-UHFFFAOYSA-N.
| Molecular formula | C19H14 |
|---|---|
| Molecular weight | 242.3 g/mol |
| IUPAC name | 10-methylbenzo[a]anthracene |
| InChIKey | WUMGYHICFXGLAB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC3=C(C=CC4=CC=CC=C43)C=C2C=C1 |
Computed by PubChem (NCBI)