CAS 2381097-10-3 appears in our catalog under these names: (S)-2-((tert-Butoxycarbonyl)amino)-6-hydroxy-4-oxohexanoic acid, 98%, Photo–lysine Derivative 1, Photo-lysine Derivative 1, 96%. Offered by: AmBeed, GLPBio, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
(2S)-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohexanoic acid (CAS 2381097-10-3) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: (2S)-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohexanoic acid. InChIKey: BKWJHUDFPLJFIC-QMMMGPOBSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (2S)-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxohexanoic acid |
| InChIKey | BKWJHUDFPLJFIC-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)CCO)C(=O)O |
Computed by PubChem (NCBI)