CAS 2381119-08-8 appears in our catalog under these names: (R)-1-(tert-Butoxycarbonyl)-4,4-dimethylpyrrolidine-3-carboxylic acid, 98%, (3R)-1-[(tert-butoxy)carbonyl]-4,4-dimethylpyrrolidine-3-carboxylic acid. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
(3R)-4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 2381119-08-8) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (3R)-4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: KSTVRUBGONQZCA-MRVPVSSYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (3R)-4,4-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | KSTVRUBGONQZCA-MRVPVSSYSA-N |
| SMILES | CC1(CN(C[C@@H]1C(=O)O)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)