Products 2381377-85-9
CAS 2381377-85-9 appears in our catalog under these names: (R)-2-(5-Fluoro-2-methoxypyridin-4-yl)propanoic acid, 95%, (R)-2-(5-Fluoro-2-methoxypyridin-4-yl)propanoic acid, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g, 100mg, 250mg.
(2R)-2-(5-fluoro-2-methoxy-4-pyridinyl)propanoic acid (CAS 2381377-85-9) is a chemical compound with the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. IUPAC name: (2R)-2-(5-fluoro-2-methoxy-4-pyridinyl)propanoic acid. InChIKey: NHKBBXXJVBCQES-RXMQYKEDSA-N.
| Molecular formula | C9H10FNO3 |
|---|---|
| Molecular weight | 199.18 g/mol |
| IUPAC name | (2R)-2-(5-fluoro-2-methoxy-4-pyridinyl)propanoic acid |
| InChIKey | NHKBBXXJVBCQES-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=CC(=NC=C1F)OC)C(=O)O |
Computed by PubChem (NCBI)