Products 2381513-85-3
CAS 2381513-85-3 is the registry number for tert-butyl (5S)-6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (5S)-6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate (CAS 2381513-85-3) is a chemical compound with the molecular formula C12H22N2O3 and a molecular weight of 242.31 g/mol. IUPAC name: tert-butyl (5S)-6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate. InChIKey: VESCRSHLXRKQFF-LBPRGKRZSA-N.
| Molecular formula | C12H22N2O3 |
|---|---|
| Molecular weight | 242.31 g/mol |
| IUPAC name | tert-butyl (5S)-6-oxa-2,9-diazaspiro[4.5]decane-9-carboxylate |
| InChIKey | VESCRSHLXRKQFF-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@@]2(C1)CCNC2 |
Computed by PubChem (NCBI)