Products 2382231-87-8
CAS 2382231-87-8 is the registry number for (2R,4S)-4-[(tert-butoxycarbonylamino)methyl]pyrrolidine-2-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(2R,4S)-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pyrrolidine-2-carboxylic acid (CAS 2382231-87-8) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: (2R,4S)-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pyrrolidine-2-carboxylic acid. InChIKey: OWYOKFWKLQWMIL-JGVFFNPUSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | (2R,4S)-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]pyrrolidine-2-carboxylic acid |
| InChIKey | OWYOKFWKLQWMIL-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H]1C[C@@H](NC1)C(=O)O |
Computed by PubChem (NCBI)