Products 2382302-88-5
CAS 2382302-88-5 is the registry number for 1-Benzyl 3-methyl (S)-3-methylpiperidine-1,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-benzyl 3-O-methyl (3S)-3-methylpiperidine-1,3-dicarboxylate (CAS 2382302-88-5) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: 1-O-benzyl 3-O-methyl (3S)-3-methylpiperidine-1,3-dicarboxylate. InChIKey: OBQNDANRDMXAIE-INIZCTEOSA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | 1-O-benzyl 3-O-methyl (3S)-3-methylpiperidine-1,3-dicarboxylate |
| InChIKey | OBQNDANRDMXAIE-INIZCTEOSA-N |
| SMILES | C[C@@]1(CCCN(C1)C(=O)OCC2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)