Products 2383914-72-3
CAS 2383914-72-3 is the registry number for 1,2-Dibromo-4-chloro-5-(trifluoromethyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,2-dibromo-4-chloro-5-(trifluoromethyl)benzene (CAS 2383914-72-3) is a chemical compound with the molecular formula C7H2Br2ClF3 and a molecular weight of 338.34 g/mol. IUPAC name: 1,2-dibromo-4-chloro-5-(trifluoromethyl)benzene. InChIKey: WQTFIKWIFYDRBH-UHFFFAOYSA-N.
| Molecular formula | C7H2Br2ClF3 |
|---|---|
| Molecular weight | 338.34 g/mol |
| IUPAC name | 1,2-dibromo-4-chloro-5-(trifluoromethyl)benzene |
| InChIKey | WQTFIKWIFYDRBH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)Br)Cl)C(F)(F)F |
Computed by PubChem (NCBI)