Products 2384058-75-5
CAS 2384058-75-5 is the registry number for 3-Chloro-2-ethoxy-4-methylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-chloro-2-ethoxy-4-methylbenzoic acid (CAS 2384058-75-5) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 214.64 g/mol. IUPAC name: 3-chloro-2-ethoxy-4-methylbenzoic acid. InChIKey: MWQVJFTXCRPTDR-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3 |
|---|---|
| Molecular weight | 214.64 g/mol |
| IUPAC name | 3-chloro-2-ethoxy-4-methylbenzoic acid |
| InChIKey | MWQVJFTXCRPTDR-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1Cl)C)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Chloro-2-ethoxy-4-methylbenzoic acid