Products 2384064-67-7

CAS 2384064-67-7 is the registry number for 5-Hydroxy-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-hydroxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid (CAS 2384064-67-7) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 5-hydroxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid. InChIKey: CKVIKJUVGRDGPK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8N2O3
Molecular weight168.15 g/mol
IUPAC name5-hydroxy-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid
InChIKeyCKVIKJUVGRDGPK-UHFFFAOYSA-N
SMILESC1C(CN2C1=CC(=N2)C(=O)O)O

Computed by PubChem (NCBI)