Products 2384098-85-3
CAS 2384098-85-3 is the registry number for 6-bromo-3,3-dimethyl-2,4-dihydro-1H-isoquinoline, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-bromo-3,3-dimethyl-2,4-dihydro-1H-isoquinoline (CAS 2384098-85-3) is a chemical compound with the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. IUPAC name: 6-bromo-3,3-dimethyl-2,4-dihydro-1H-isoquinoline. InChIKey: LIZMXUHEVHNPNK-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN |
|---|---|
| Molecular weight | 240.14 g/mol |
| IUPAC name | 6-bromo-3,3-dimethyl-2,4-dihydro-1H-isoquinoline |
| InChIKey | LIZMXUHEVHNPNK-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(CN1)C=CC(=C2)Br)C |
Computed by PubChem (NCBI)