Products 23844-56-6
CAS 23844-56-6 appears in our catalog under these names: MCPP Methyl Ester, Mecoprop-methyl ester, Mecoprop-methyl ester 10 µg/mL in Isooctane, Mecoprop-methyl ester, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 250mg, 100mg, 10ml, 1x5ml.
Methyl 2-(4-chloro-2-methylphenoxy)propanoate (CAS 23844-56-6) is a chemical compound with the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. IUPAC name: methyl 2-(4-chloro-2-methylphenoxy)propanoate. InChIKey: YWGAULPFWIQKRB-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO3 |
|---|---|
| Molecular weight | 228.67 g/mol |
| IUPAC name | methyl 2-(4-chloro-2-methylphenoxy)propanoate |
| InChIKey | YWGAULPFWIQKRB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)OC(C)C(=O)OC |
Computed by PubChem (NCBI)