Products 2384449-98-1
CAS 2384449-98-1 is the registry number for 2-Chloro-5-fluoro-3-formylbenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
2-chloro-5-fluoro-3-formylbenzoic acid (CAS 2384449-98-1) is a chemical compound with the molecular formula C8H4ClFO3 and a molecular weight of 202.56 g/mol. IUPAC name: 2-chloro-5-fluoro-3-formylbenzoic acid. InChIKey: STHLNCPVGMFRIC-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFO3 |
|---|---|
| Molecular weight | 202.56 g/mol |
| IUPAC name | 2-chloro-5-fluoro-3-formylbenzoic acid |
| InChIKey | STHLNCPVGMFRIC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)Cl)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
2-Chloro-5-fluoro-3-formylbenZoic acid