Products 2385884-08-0
CAS 2385884-08-0 is the registry number for 3-Chloro-4-fluoro-5-formylbenzoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
3-chloro-4-fluoro-5-formylbenzoic acid (CAS 2385884-08-0) is a chemical compound with the molecular formula C8H4ClFO3 and a molecular weight of 202.56 g/mol. IUPAC name: 3-chloro-4-fluoro-5-formylbenzoic acid. InChIKey: CTDJMWVIPJBYHU-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFO3 |
|---|---|
| Molecular weight | 202.56 g/mol |
| IUPAC name | 3-chloro-4-fluoro-5-formylbenzoic acid |
| InChIKey | CTDJMWVIPJBYHU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)F)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Chloro-4-fluoro-5-formylbenzoic acid