Products 250642-59-2
CAS 250642-59-2 is the registry number for 4-Chloro-2-fluoro-α-oxobenzeneacetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-chloro-2-fluorophenyl)-2-oxoacetic acid (CAS 250642-59-2) is a chemical compound with the molecular formula C8H4ClFO3 and a molecular weight of 202.56 g/mol. IUPAC name: 2-(4-chloro-2-fluorophenyl)-2-oxoacetic acid. InChIKey: UWDUDKCVPHMIOM-UHFFFAOYSA-N.
| Molecular formula | C8H4ClFO3 |
|---|---|
| Molecular weight | 202.56 g/mol |
| IUPAC name | 2-(4-chloro-2-fluorophenyl)-2-oxoacetic acid |
| InChIKey | UWDUDKCVPHMIOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)C(=O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(4-chloro-2-fluorophenyl)-2-oxoacetic acid, 4-Chloro-2-fluoro-alpha-oxobenzeneacetic acid, (4-Chloro-2-fluorophenyl)(oxo)acetic acid, 4-Chloro-2-fluoro-|A-oxobenzeneacetic acid, 4-Chloro-2-fluoro-I+/--oxobenzeneacetic acid, Benzeneacetic acid, 4-chloro-2-fluoro-?-oxo-, Benzeneacetic acid, 4-chloro-2-fluoro-alpha-oxo-