Products 2385616-54-4
CAS 2385616-54-4 is the registry number for 3-Bromo-4-(trifluoromethyl)isoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-4-(trifluoromethyl)isoquinoline (CAS 2385616-54-4) is a chemical compound with the molecular formula C10H5BrF3N and a molecular weight of 276.05 g/mol. IUPAC name: 3-bromo-4-(trifluoromethyl)isoquinoline. InChIKey: RALKUKNQUWLENV-UHFFFAOYSA-N.
| Molecular formula | C10H5BrF3N |
|---|---|
| Molecular weight | 276.05 g/mol |
| IUPAC name | 3-bromo-4-(trifluoromethyl)isoquinoline |
| InChIKey | RALKUKNQUWLENV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=NC(=C2C(F)(F)F)Br |
Computed by PubChem (NCBI)