Products 2386674-47-9
CAS 2386674-47-9 is the registry number for 1-Bromo-2-chloro-3-ethoxy-5-fluorobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2-chloro-3-ethoxy-5-fluorobenzene (CAS 2386674-47-9) is a chemical compound with the molecular formula C8H7BrClFO and a molecular weight of 253.49 g/mol. IUPAC name: 1-bromo-2-chloro-3-ethoxy-5-fluorobenzene. InChIKey: YUWCABNKXAWILP-UHFFFAOYSA-N.
| Molecular formula | C8H7BrClFO |
|---|---|
| Molecular weight | 253.49 g/mol |
| IUPAC name | 1-bromo-2-chloro-3-ethoxy-5-fluorobenzene |
| InChIKey | YUWCABNKXAWILP-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1)F)Br)Cl |
Computed by PubChem (NCBI)