Products 2387123-36-4
CAS 2387123-36-4 is the registry number for tert-Butyl 2-thia-6-azaspiro[3.4]octane-6-carboxylate 2,2-dioxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 2,2-dioxo-2lambda6-thia-7-azaspiro[3.4]octane-7-carboxylate (CAS 2387123-36-4) is a chemical compound with the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. IUPAC name: tert-butyl 2,2-dioxo-2lambda6-thia-7-azaspiro[3.4]octane-7-carboxylate. InChIKey: UTCRIKWHKBZRJZ-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4S |
|---|---|
| Molecular weight | 261.34 g/mol |
| IUPAC name | tert-butyl 2,2-dioxo-2lambda6-thia-7-azaspiro[3.4]octane-7-carboxylate |
| InChIKey | UTCRIKWHKBZRJZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)CS(=O)(=O)C2 |
Computed by PubChem (NCBI)