CAS 2387567-84-0 appears in our catalog under these names: tert-butyl (3R)-pyrrolidine-3-carboxylate oxalic acid, 97%, 97%, TERT-BUTYL (3R)-PYRROLIDINE-3-CARBOXYLATE,OXALIC ACID, 98%, (R)-tert-Butyl pyrrolidine-3-carboxylate oxalate, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
Tert-butyl (3R)-pyrrolidine-3-carboxylate;oxalic acid (CAS 2387567-84-0) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: tert-butyl (3R)-pyrrolidine-3-carboxylate;oxalic acid. InChIKey: OHURXTQKCCBVSU-OGFXRTJISA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | tert-butyl (3R)-pyrrolidine-3-carboxylate;oxalic acid |
| InChIKey | OHURXTQKCCBVSU-OGFXRTJISA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCNC1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)