Products 2387601-87-6
CAS 2387601-87-6 is the registry number for 3-Bromo-5,6,7,8-tetrahydro-9H-pyrido[2,3-c]azepin-9-one, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g.
3-bromo-5,6,7,8-tetrahydropyrido[2,3-c]azepin-9-one (CAS 2387601-87-6) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 3-bromo-5,6,7,8-tetrahydropyrido[2,3-c]azepin-9-one. InChIKey: VRYKWQJKUXBFKC-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 3-bromo-5,6,7,8-tetrahydropyrido[2,3-c]azepin-9-one |
| InChIKey | VRYKWQJKUXBFKC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)NC1)N=CC(=C2)Br |
Computed by PubChem (NCBI)