Products 2388490-12-6

CAS 2388490-12-6 is the registry number for Enrofloxacin Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-cyclopropyl-7-ethoxy-6-fluoro-4-oxoquinoline-3-carboxylic acid (CAS 2388490-12-6) is a chemical compound with the molecular formula C15H14FNO4 and a molecular weight of 291.27 g/mol. IUPAC name: 1-cyclopropyl-7-ethoxy-6-fluoro-4-oxoquinoline-3-carboxylic acid. InChIKey: MSKNDNOXGYCHLK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14FNO4
Molecular weight291.27 g/mol
IUPAC name1-cyclopropyl-7-ethoxy-6-fluoro-4-oxoquinoline-3-carboxylic acid
InChIKeyMSKNDNOXGYCHLK-UHFFFAOYSA-N
SMILESCCOC1=C(C=C2C(=C1)N(C=C(C2=O)C(=O)O)C3CC3)F

Computed by PubChem (NCBI)