Products 431058-46-7
CAS 431058-46-7 appears in our catalog under these names: Levofloxacin Impurity 25, Levofloxacin Impurity I, Levofloxacin Impurity 21. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl (2S)-6-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-11-carboxylate (CAS 431058-46-7) is a chemical compound with the molecular formula C15H14FNO4 and a molecular weight of 291.27 g/mol. IUPAC name: ethyl (2S)-6-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-11-carboxylate. InChIKey: ARBUBLJBNIYBJU-QMMMGPOBSA-N.
| Molecular formula | C15H14FNO4 |
|---|---|
| Molecular weight | 291.27 g/mol |
| IUPAC name | ethyl (2S)-6-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13),11-tetraene-11-carboxylate |
| InChIKey | ARBUBLJBNIYBJU-QMMMGPOBSA-N |
| SMILES | CCOC(=O)C1=CN2[C@H](COC3=C(C=CC(=C32)C1=O)F)C |
Computed by PubChem (NCBI)