Products 2444608-46-0
CAS 2444608-46-0 is the registry number for 3-[4-(Aminomethyl)-2-fluorophenoxy]-4-methoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-[4-(aminomethyl)-2-fluorophenoxy]-4-methoxybenzoic acid (CAS 2444608-46-0) is a chemical compound with the molecular formula C15H14FNO4 and a molecular weight of 291.27 g/mol. IUPAC name: 3-[4-(aminomethyl)-2-fluorophenoxy]-4-methoxybenzoic acid. InChIKey: BDOLYGZGTCAYMA-UHFFFAOYSA-N.
| Molecular formula | C15H14FNO4 |
|---|---|
| Molecular weight | 291.27 g/mol |
| IUPAC name | 3-[4-(aminomethyl)-2-fluorophenoxy]-4-methoxybenzoic acid |
| InChIKey | BDOLYGZGTCAYMA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)OC2=C(C=C(C=C2)CN)F |
Computed by PubChem (NCBI)