CAS 23886-64-8 appears in our catalog under these names: 2,5-Dibromobenzenesulfonyl chloride, 97%, 2,5–Dibromobenzenesulfonyl chloride, 2,5-Dibromobenzenesulfonyl chloride, 99% , 2,5-Dibromobenzenesulfonyl chloride, 95%, 2,5-Dibromobenzene-1-sulfonyl chloride, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 100g.
2,5-dibromobenzenesulfonyl chloride (CAS 23886-64-8) is a chemical compound with the molecular formula C6H3Br2ClO2S and a molecular weight of 334.41 g/mol. IUPAC name: 2,5-dibromobenzenesulfonyl chloride. InChIKey: ZLMPLIWURYRGEB-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2ClO2S |
|---|---|
| Molecular weight | 334.41 g/mol |
| IUPAC name | 2,5-dibromobenzenesulfonyl chloride |
| InChIKey | ZLMPLIWURYRGEB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)