CAS 39213-20-2 appears in our catalog under these names: 3,5-Dibromobenzenesulfonyl chloride, 98%, 3,5-Dibromobenzene-1-sulfonyl chloride, 97%. Offered by: Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g.
3,5-dibromobenzenesulfonyl chloride (CAS 39213-20-2) is a chemical compound with the molecular formula C6H3Br2ClO2S and a molecular weight of 334.41 g/mol. IUPAC name: 3,5-dibromobenzenesulfonyl chloride. InChIKey: PCSALOWJAYHZFZ-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2ClO2S |
|---|---|
| Molecular weight | 334.41 g/mol |
| IUPAC name | 3,5-dibromobenzenesulfonyl chloride |
| InChIKey | PCSALOWJAYHZFZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)