CAS 72256-95-2 appears in our catalog under these names: 2,4-Dibromobenzenesulfonyl chloride, 95%, 2,4-Dibromobenzenesulfonyl chloride, 98% , 2,4-Dibromobenzenesulphonyl chloride, 2,4-Dibromobenzenesulfonyl chloride, 96%, 2,4-Dibromobenzene-1-sulfonyl chloride, 97%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 25g.
2,4-dibromobenzenesulfonyl chloride (CAS 72256-95-2) is a chemical compound with the molecular formula C6H3Br2ClO2S and a molecular weight of 334.41 g/mol. IUPAC name: 2,4-dibromobenzenesulfonyl chloride. InChIKey: OMOXIKAWVFDFNX-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2ClO2S |
|---|---|
| Molecular weight | 334.41 g/mol |
| IUPAC name | 2,4-dibromobenzenesulfonyl chloride |
| InChIKey | OMOXIKAWVFDFNX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)