Products 2389078-55-9
CAS 2389078-55-9 is the registry number for Boc-L-Me2Ahp-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g.
(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]heptanoic acid (CAS 2389078-55-9) is a chemical compound with the molecular formula C13H25NO4 and a molecular weight of 259.34 g/mol. IUPAC name: (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]heptanoic acid. InChIKey: BUWSQPBKRHWTEX-JTQLQIEISA-N.
| Molecular formula | C13H25NO4 |
|---|---|
| Molecular weight | 259.34 g/mol |
| IUPAC name | (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]heptanoic acid |
| InChIKey | BUWSQPBKRHWTEX-JTQLQIEISA-N |
| SMILES | CCCCC[C@@H](C(=O)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)