CAS 23894-12-4 appears in our catalog under these names: 6-Amino-1-naphthol, >98.0%(HPLC), 6-Aminonaphthalen-1-ol 98%, 6-Aminonaphthalen-1-ol, 98%, 98%, 6-Amino-1-naphthol, 98%. Offered by: TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
6-aminonaphthalen-1-ol (CAS 23894-12-4) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 6-aminonaphthalen-1-ol. InChIKey: QYFYIOWLBSPSDM-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 6-aminonaphthalen-1-ol |
| InChIKey | QYFYIOWLBSPSDM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)N)C(=C1)O |
Computed by PubChem (NCBI)