CAS 2390380-41-1 is the registry number for Ethyl 2-(2-bromo-6,6-dimethyl-4-oxo-4,6-dihydro-5H-thieno[2,3-c]pyrrol-5-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(2-bromo-6,6-dimethyl-4-oxothieno[2,3-c]pyrrol-5-yl)acetate (CAS 2390380-41-1) is a chemical compound with the molecular formula C12H14BrNO3S and a molecular weight of 332.22 g/mol. IUPAC name: ethyl 2-(2-bromo-6,6-dimethyl-4-oxothieno[2,3-c]pyrrol-5-yl)acetate. InChIKey: ODHFDHGXZVYGKW-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO3S |
|---|---|
| Molecular weight | 332.22 g/mol |
| IUPAC name | ethyl 2-(2-bromo-6,6-dimethyl-4-oxothieno[2,3-c]pyrrol-5-yl)acetate |
| InChIKey | ODHFDHGXZVYGKW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C(=O)C2=C(C1(C)C)SC(=C2)Br |
Computed by PubChem (NCBI)