CAS 1153390-81-8 is the registry number for Methyl 1-(5-bromothiophene-3-carbonyl)piperidine-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1-(5-bromothiophene-3-carbonyl)piperidine-4-carboxylate (CAS 1153390-81-8) is a chemical compound with the molecular formula C12H14BrNO3S and a molecular weight of 332.22 g/mol. IUPAC name: methyl 1-(5-bromothiophene-3-carbonyl)piperidine-4-carboxylate. InChIKey: ILZQHEDLDUJBAX-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO3S |
|---|---|
| Molecular weight | 332.22 g/mol |
| IUPAC name | methyl 1-(5-bromothiophene-3-carbonyl)piperidine-4-carboxylate |
| InChIKey | ILZQHEDLDUJBAX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCN(CC1)C(=O)C2=CSC(=C2)Br |
Computed by PubChem (NCBI)