CAS 1092574-69-0 is the registry number for 2-(4-Bromophenyl)-1-(1,1-dioxidothiomorpholino)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromophenyl)-1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone (CAS 1092574-69-0) is a chemical compound with the molecular formula C12H14BrNO3S and a molecular weight of 332.22 g/mol. IUPAC name: 2-(4-bromophenyl)-1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone. InChIKey: ICNFRWXWMGMHEN-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO3S |
|---|---|
| Molecular weight | 332.22 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone |
| InChIKey | ICNFRWXWMGMHEN-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C(=O)CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)