CAS 1177093-18-3 is the registry number for 6–(4–Bromophenylsulfonyl)–1–oxa–6–azaspiro(2·5)octane. Offered by: GLPBio. Available pack sizes: 1g, 5g.
6-(4-bromophenyl)sulfonyl-1-oxa-6-azaspiro[2.5]octane (CAS 1177093-18-3) is a chemical compound with the molecular formula C12H14BrNO3S and a molecular weight of 332.22 g/mol. IUPAC name: 6-(4-bromophenyl)sulfonyl-1-oxa-6-azaspiro[2.5]octane. InChIKey: YFIKJPDOJGZVRX-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO3S |
|---|---|
| Molecular weight | 332.22 g/mol |
| IUPAC name | 6-(4-bromophenyl)sulfonyl-1-oxa-6-azaspiro[2.5]octane |
| InChIKey | YFIKJPDOJGZVRX-UHFFFAOYSA-N |
| SMILES | C1CN(CCC12CO2)S(=O)(=O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)