Products 239080-01-4

CAS 239080-01-4 is the registry number for 2-(Trifluoromethylthio)phenylacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[2-(trifluoromethylsulfanyl)phenyl]acetic acid (CAS 239080-01-4) is a chemical compound with the molecular formula C9H7F3O2S and a molecular weight of 236.21 g/mol. IUPAC name: 2-[2-(trifluoromethylsulfanyl)phenyl]acetic acid. InChIKey: FVVZHMXCYDAXJG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7F3O2S
Molecular weight236.21 g/mol
IUPAC name2-[2-(trifluoromethylsulfanyl)phenyl]acetic acid
InChIKeyFVVZHMXCYDAXJG-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)CC(=O)O)SC(F)(F)F

Computed by PubChem (NCBI)