Products 53985-40-3
CAS 53985-40-3 appears in our catalog under these names: 3-(Methylthio)-5-(trifluoromethyl)benzoic acid, 3-(Methylthio)-5-(trifluoromethyl)benzoic acid, 95%. Offered by: Fluorochem, Combi-blocks. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
3-methylsulfanyl-5-(trifluoromethyl)benzoic acid (CAS 53985-40-3) is a chemical compound with the molecular formula C9H7F3O2S and a molecular weight of 236.21 g/mol. IUPAC name: 3-methylsulfanyl-5-(trifluoromethyl)benzoic acid. InChIKey: FIYBTFYOOMVNIG-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2S |
|---|---|
| Molecular weight | 236.21 g/mol |
| IUPAC name | 3-methylsulfanyl-5-(trifluoromethyl)benzoic acid |
| InChIKey | FIYBTFYOOMVNIG-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=CC(=C1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)