Products 349-83-7

CAS 349-83-7 is the registry number for ([3-(Trifluoromethyl)phenyl]thio)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

2-[3-(trifluoromethyl)phenyl]sulfanylacetic acid (CAS 349-83-7) is a chemical compound with the molecular formula C9H7F3O2S and a molecular weight of 236.21 g/mol. IUPAC name: 2-[3-(trifluoromethyl)phenyl]sulfanylacetic acid. InChIKey: YBUZSRSMQIEFBR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7F3O2S
Molecular weight236.21 g/mol
IUPAC name2-[3-(trifluoromethyl)phenyl]sulfanylacetic acid
InChIKeyYBUZSRSMQIEFBR-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)SCC(=O)O)C(F)(F)F

Computed by PubChem (NCBI)