Products 239103-32-3
CAS 239103-32-3 is the registry number for 2,2'-(Propane-2,2-diyl)bis(4,4-dimethyl-4,5-dihydrooxazole), 97%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]-4,4-dimethyl-5H-1,3-oxazole (CAS 239103-32-3) is a chemical compound with the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. IUPAC name: 2-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]-4,4-dimethyl-5H-1,3-oxazole. InChIKey: OBUCFPSZQJSSKR-UHFFFAOYSA-N.
| Molecular formula | C13H22N2O2 |
|---|---|
| Molecular weight | 238.33 g/mol |
| IUPAC name | 2-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propan-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
| InChIKey | OBUCFPSZQJSSKR-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C(C)(C)C2=NC(CO2)(C)C)C |
Computed by PubChem (NCBI)