CAS 239136-56-2 is the registry number for 7-Methoxy-4-aminomethylcoumarin, 98.00%. Offered by: Chemat. Available pack sizes: 10mg, 25mg.
4-(aminomethyl)-7-methoxychromen-2-one (CAS 239136-56-2) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 4-(aminomethyl)-7-methoxychromen-2-one. InChIKey: JTWMBPZRYBLNNG-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 4-(aminomethyl)-7-methoxychromen-2-one |
| InChIKey | JTWMBPZRYBLNNG-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CC(=O)O2)CN |
Computed by PubChem (NCBI)