CAS 2393-53-5 appears in our catalog under these names: Estradiol Benzoate EP Impurity G, Estradiol Benzoate Impurity 7 (Estradiol Benzoate EP Impurity G), Estradiol EP Impurity G, ESTRONE BENZOATE. Offered by: Chemat Brand, Hubei YoungXin, Mikromol, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] benzoate (CAS 2393-53-5) is a chemical compound with the molecular formula C25H26O3 and a molecular weight of 374.5 g/mol. IUPAC name: [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] benzoate. InChIKey: HKUKRSLIEVXDMS-APDHKMKFSA-N.
| Molecular formula | C25H26O3 |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] benzoate |
| InChIKey | HKUKRSLIEVXDMS-APDHKMKFSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)OC(=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)