CAS 496868-77-0 appears in our catalog under these names: Adarotene, Adarotene/ 99.68% (existing batch purity), Adarotene, 99%, 99%, Adarotene, 99.15%, (2E)-3-(4'-Hydroxy-3'-tricyclo[3.3.1.13,7]dec-1-yl[1,1'-biphenyl]-4-yl)-2-propenoic acid, 99%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg.
(E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]phenyl]prop-2-enoic acid (CAS 496868-77-0) is a chemical compound with the molecular formula C25H26O3 and a molecular weight of 374.5 g/mol. IUPAC name: (E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]phenyl]prop-2-enoic acid. InChIKey: QAWBIEIZDDIEMW-FPYGCLRLSA-N.
| Molecular formula | C25H26O3 |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | (E)-3-[4-[3-(1-adamantyl)-4-hydroxyphenyl]phenyl]prop-2-enoic acid |
| InChIKey | QAWBIEIZDDIEMW-FPYGCLRLSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C4=C(C=CC(=C4)C5=CC=C(C=C5)/C=C/C(=O)O)O |
Computed by PubChem (NCBI)