Products 26789-44-6
CAS 26789-44-6 is the registry number for Equilin Impurity 11. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
[(9S,13S,14S,17S)-17-hydroxy-13-methyl-6,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-yl] benzoate (CAS 26789-44-6) is a chemical compound with the molecular formula C25H26O3 and a molecular weight of 374.5 g/mol. IUPAC name: [(9S,13S,14S,17S)-17-hydroxy-13-methyl-6,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-yl] benzoate. InChIKey: UWWDRHYDMTYSBM-GIQJJWITSA-N.
| Molecular formula | C25H26O3 |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | [(9S,13S,14S,17S)-17-hydroxy-13-methyl-6,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-3-yl] benzoate |
| InChIKey | UWWDRHYDMTYSBM-GIQJJWITSA-N |
| SMILES | C[C@]12CC[C@H]3C(=CCC4=C3C=CC(=C4)OC(=O)C5=CC=CC=C5)[C@@H]1CC[C@@H]2O |
Computed by PubChem (NCBI)
Synonyms:
3-O-Benzyl-17beta-Dihydro Equilin