CAS 23935-14-0 appears in our catalog under these names: 3-(Dimethylamino)-1-(3,4-dimethylphenyl)propan-1-one hydrochloride, 95%, 3-(Dimethylamino)-1-(3,4-dimethylphenyl)propan-1-one hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-(dimethylamino)-1-(3,4-dimethylphenyl)propan-1-one;hydrochloride (CAS 23935-14-0) is a chemical compound with the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. IUPAC name: 3-(dimethylamino)-1-(3,4-dimethylphenyl)propan-1-one;hydrochloride. InChIKey: ZNCZUACZBJPGTA-UHFFFAOYSA-N.
| Molecular formula | C13H20ClNO |
|---|---|
| Molecular weight | 241.76 g/mol |
| IUPAC name | 3-(dimethylamino)-1-(3,4-dimethylphenyl)propan-1-one;hydrochloride |
| InChIKey | ZNCZUACZBJPGTA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)CCN(C)C)C.Cl |
Computed by PubChem (NCBI)