Products 23948-77-8
CAS 23948-77-8 appears in our catalog under these names: (1,1²-Biphenyl)-3-ylacetic acid, 2-([1,1'-Biphenyl]-3-yl)acetic acid, 95%, 95%, Biphenyl-3-ylacetic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 2g, 10g, 5g, 100mg, 250mg.
2-(3-phenylphenyl)acetic acid (CAS 23948-77-8) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 2-(3-phenylphenyl)acetic acid. InChIKey: VLQLJPWPRYUYMK-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 2-(3-phenylphenyl)acetic acid |
| InChIKey | VLQLJPWPRYUYMK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-biphenylylacetic acid, 2-([1,1'-Biphenyl]-3-yl)acetic acid, (3-Phenylphenyl)acetic acid, 2-(3-phenylphenyl)acetic acid, Biphenyl-3-yl-acetic acid, Biphenyl-3-ylacetic acid, (1,1'-Biphenyl)-3-acetic acid, [1,1'-Biphenyl]-3-acetic acid, (1,1'-Biphenyl)-3-acetic acid (9CI), Acetic acid, 3-biphenylyl-