CAS 24010-56-8 appears in our catalog under these names: 2,6-Dimethylbenzenesulfonamide, 97%, 2,6-Dimethylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 2,5g.
2,6-dimethylbenzenesulfonamide (CAS 24010-56-8) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: 2,6-dimethylbenzenesulfonamide. InChIKey: ZEBMBNNVUIWRIC-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | 2,6-dimethylbenzenesulfonamide |
| InChIKey | ZEBMBNNVUIWRIC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)S(=O)(=O)N |
Computed by PubChem (NCBI)