CAS 24021-44-1 appears in our catalog under these names: Desmethyl Ketoprofen Methyl Ester, Desmethyl Ketoprofen Methyl Ester, ≥98.0%, ≥98.0%. Offered by: TRC, Chemat. Available pack sizes: 250mg, 50mg, 100mg.
Methyl 2-(3-benzoylphenyl)acetate (CAS 24021-44-1) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 254.28 g/mol. IUPAC name: methyl 2-(3-benzoylphenyl)acetate. InChIKey: QTXILVCSTXQKLF-UHFFFAOYSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | methyl 2-(3-benzoylphenyl)acetate |
| InChIKey | QTXILVCSTXQKLF-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=CC=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)