CAS 2403-27-2 is the registry number for 1-(4-Bromophenyl)-3-phenylprop-2-en-1-one, 95+%. Offered by: AmBeed. Available pack sizes: 25g.
(E)-1-(4-bromophenyl)-3-phenylprop-2-en-1-one (CAS 2403-27-2) is a chemical compound with the molecular formula C15H11BrO and a molecular weight of 287.15 g/mol. IUPAC name: (E)-1-(4-bromophenyl)-3-phenylprop-2-en-1-one. InChIKey: QMHDTKUBDZUMNH-IZZDOVSWSA-N.
| Molecular formula | C15H11BrO |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | (E)-1-(4-bromophenyl)-3-phenylprop-2-en-1-one |
| InChIKey | QMHDTKUBDZUMNH-IZZDOVSWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)