Products 39696-13-4
CAS 39696-13-4 is the registry number for 2-Bromo-1-(9h-fluoren-2-yl)ethan-1-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-bromo-1-(9H-fluoren-2-yl)ethanone (CAS 39696-13-4) is a chemical compound with the molecular formula C15H11BrO and a molecular weight of 287.15 g/mol. IUPAC name: 2-bromo-1-(9H-fluoren-2-yl)ethanone. InChIKey: GRFJJWWZDMCMGT-UHFFFAOYSA-N.
| Molecular formula | C15H11BrO |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | 2-bromo-1-(9H-fluoren-2-yl)ethanone |
| InChIKey | GRFJJWWZDMCMGT-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C3=C1C=C(C=C3)C(=O)CBr |
Computed by PubChem (NCBI)