Products 24167-44-0
CAS 24167-44-0 is the registry number for Cyclobenzaprine Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
9-bromotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-2-one (CAS 24167-44-0) is a chemical compound with the molecular formula C15H11BrO and a molecular weight of 287.15 g/mol. IUPAC name: 9-bromotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-2-one. InChIKey: UDCDBLUACWWVLI-UHFFFAOYSA-N.
| Molecular formula | C15H11BrO |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | 9-bromotricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaen-2-one |
| InChIKey | UDCDBLUACWWVLI-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC=C2C(=O)C3=CC=CC=C31)Br |
Computed by PubChem (NCBI)